C24H22BrN3O5 — CID 3651381
3-[[2-bromo-6-methoxy-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 3651381) has the molecular formula C24H22BrN3O5 and a molecular weight of 512.36 g/mol. Its IUPAC name is 3-[[2-bromo-6-methoxy-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-6-methoxy-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3651381 |
| Molecular Formula | C24H22BrN3O5 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 3-[[2-bromo-6-methoxy-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=NNC(=O)Nc2ccccc2C)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H22BrN3O5/c1-15-6-3-4-9-20(15)27-24(31)28-26-13-17-11-19(25)22(21(12-17)32-2)33-14-16-7-5-8-18(10-16)23(29)30/h3-13H,14H2,1-2H3,(H,29,30)(H2,27,28,31) |
| InChIKey | JPXAOXRDKJYUFM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|