C23H22BrN3O2 — CID 5234389
1-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5234389) has the molecular formula C23H22BrN3O2 and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5234389 |
| Molecular Formula | C23H22BrN3O2 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 1-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1cccc(COc2ccc(C=NNC(=O)Nc3ccccc3C)cc2Br)c1 |
| InChI | InChI=1S/C23H22BrN3O2/c1-16-6-5-8-19(12-16)15-29-22-11-10-18(13-20(22)24)14-25-27-23(28)26-21-9-4-3-7-17(21)2/h3-14H,15H2,1-2H3,(H2,26,27,28) |
| InChIKey | SJDSHARIZPDGFC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|