C15H14BrN3O2 — CID 136822085
1-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 136822085) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 1-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 136822085 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 1-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)N/N=C\c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C15H14BrN3O2/c1-10-4-2-3-5-13(10)18-15(21)19-17-9-11-6-7-14(20)12(16)8-11/h2-9,20H,1H3,(H2,18,19,21)/b17-9- |
| InChIKey | MHMVQGQTIIFDBV-MFOYZWKCSA-N |
| XLogP | 3.62 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|