C22H19BrClN3O2 — CID 5233343
1-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5233343) has the molecular formula C22H19BrClN3O2 and a molecular weight of 472.77 g/mol. Its IUPAC name is 1-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5233343 |
| Molecular Formula | C22H19BrClN3O2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 1-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1ccc(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C22H19BrClN3O2/c1-15-4-2-3-5-20(15)26-22(28)27-25-13-17-8-11-21(19(23)12-17)29-14-16-6-9-18(24)10-7-16/h2-13H,14H2,1H3,(H2,26,27,28) |
| InChIKey | WAWDAPMNNRJUAJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|