C22H17BrCl3N3O2 — CID 3257710
1-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3257710) has the molecular formula C22H17BrCl3N3O2 and a molecular weight of 541.66 g/mol. Its IUPAC name is 1-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3257710 |
| Molecular Formula | C22H17BrCl3N3O2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 538.96 |
| IUPAC Name | 1-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1cc(Cl)c(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C22H17BrCl3N3O2/c1-13-4-2-3-5-20(13)28-22(30)29-27-11-14-8-17(23)21(19(26)9-14)31-12-15-6-7-16(24)10-18(15)25/h2-11H,12H2,1H3,(H2,28,29,30) |
| InChIKey | OSHVEFQHYVLOMC-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|