C17H15Cl2N3O4 — CID 3953279
2-[2,6-dichloro-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 3953279) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3953279 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[2,6-dichloro-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1cc(Cl)c(OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-10-4-2-3-5-14(10)21-17(25)22-20-8-11-6-12(18)16(13(19)7-11)26-9-15(23)24/h2-8H,9H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | ZBABMIKDMXYMPL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|