C12H13Cl2N3O3S — CID 6044123
2-[2,6-dichloro-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid (PubChem CID 6044123) has the molecular formula C12H13Cl2N3O3S and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6044123 |
| Molecular Formula | C12H13Cl2N3O3S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-[2,6-dichloro-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid |
| SMILES | CCNC(=S)N/N=C\c1cc(Cl)c(OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3O3S/c1-2-15-12(21)17-16-5-7-3-8(13)11(9(14)4-7)20-6-10(18)19/h3-5H,2,6H2,1H3,(H,18,19)(H2,15,17,21)/b16-5- |
| InChIKey | QDIADQSXJSZTNC-BNCCVWRVSA-N |
| XLogP | 2.27 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|