C17H22ClN3O7 — CID 8989936
2-[2-chloro-6-ethoxy-4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 8989936) has the molecular formula C17H22ClN3O7 and a molecular weight of 415.83 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 8989936 |
| Molecular Formula | C17H22ClN3O7 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCCCOC)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C17H22ClN3O7/c1-3-27-13-8-11(7-12(18)15(13)28-10-14(22)23)9-20-21-17(25)16(24)19-5-4-6-26-2/h7-9H,3-6,10H2,1-2H3,(H,19,24)(H,21,25)(H,22,23)/b20-9- |
| InChIKey | WZVNUBRVYKCBJO-UKWGHVSLSA-N |
| XLogP | 0.80 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|