C16H17ClN3O6- — CID 8989937
2-[2-chloro-6-ethoxy-4-[(Z)-[[2-oxo-2-(prop-2-enylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 8989937) has the molecular formula C16H17ClN3O6- and a molecular weight of 382.78 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-oxo-2-(prop-2-enylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-oxo-2-(prop-2-enylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8989937 |
| Molecular Formula | C16H17ClN3O6- |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[[2-oxo-2-(prop-2-enylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | C=CCNC(=O)C(=O)N/N=C\c1cc(Cl)c(OCC(=O)[O-])c(OCC)c1 |
| InChI | InChI=1S/C16H18ClN3O6/c1-3-5-18-15(23)16(24)20-19-8-10-6-11(17)14(26-9-13(21)22)12(7-10)25-4-2/h3,6-8H,1,4-5,9H2,2H3,(H,18,23)(H,20,24)(H,21,22)/p-1/b19-8- |
| InChIKey | WRQMCRMLJMXWNI-UWVJOHFNSA-M |
| XLogP | -0.38 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|