C15H17ClN3O6- — CID 8989905
2-[2-chloro-6-methoxy-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 8989905) has the molecular formula C15H17ClN3O6- and a molecular weight of 370.77 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-chloro-6-methoxy-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8989905 |
| Molecular Formula | C15H17ClN3O6- |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC(C)C)cc(Cl)c1OCC(=O)[O-] |
| InChI | InChI=1S/C15H18ClN3O6/c1-8(2)18-14(22)15(23)19-17-6-9-4-10(16)13(11(5-9)24-3)25-7-12(20)21/h4-6,8H,7H2,1-3H3,(H,18,22)(H,19,23)(H,20,21)/p-1/b17-6- |
| InChIKey | POFONNWYRXDRNS-FMQZQXMHSA-M |
| XLogP | -0.55 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|