C20H20Cl2N4O6 — CID 21214231
N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-N'-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxamide (PubChem CID 21214231) has the molecular formula C20H20Cl2N4O6 and a molecular weight of 483.31 g/mol. Its IUPAC name is N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-N'-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-N'-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 21214231 |
| Molecular Formula | C20H20Cl2N4O6 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-N'-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)N/N=C/c2cc(Cl)c(OC)c(OC)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H20Cl2N4O6/c1-29-15-7-11(5-13(21)17(15)31-3)9-23-25-19(27)20(28)26-24-10-12-6-14(22)18(32-4)16(8-12)30-2/h5-10H,1-4H3,(H,25,27)(H,26,28)/b23-9+,24-10? |
| InChIKey | JJTWHUMTMWTUPD-NMXSRHTDSA-N |
| XLogP | 2.63 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|