C20H22N4O8 — CID 135646994
N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide (PubChem CID 135646994) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135646994 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)N/N=C/c2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C20H22N4O8/c1-29-13-5-11(6-14(30-2)17(13)25)9-21-23-19(27)20(28)24-22-10-12-7-15(31-3)18(26)16(8-12)32-4/h5-10,25-26H,1-4H3,(H,23,27)(H,24,28)/b21-9-,22-10+ |
| InChIKey | WPJHOKCESFRJHU-CHQRTDLRSA-N |
| XLogP | 0.73 |
| TPSA | 160.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|