C17H16ClN3O5 — CID 136693036
N-(3-chlorophenyl)-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide (PubChem CID 136693036) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 136693036 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-(3-chlorophenyl)-N'-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2)cc(OC)c1O |
| InChI | InChI=1S/C17H16ClN3O5/c1-25-13-6-10(7-14(26-2)15(13)22)9-19-21-17(24)16(23)20-12-5-3-4-11(18)8-12/h3-9,22H,1-2H3,(H,20,23)(H,21,24)/b19-9- |
| InChIKey | VEKSMSXVPDRSAR-OCKHKDLRSA-N |
| XLogP | 2.15 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|