C17H18ClN3O4 — CID 19172582
1-(3-chlorophenyl)-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea (PubChem CID 19172582) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 19172582 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea |
| SMILES | COc1cc(/C=N/NC(=O)Nc2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18ClN3O4/c1-23-14-7-11(8-15(24-2)16(14)25-3)10-19-21-17(22)20-13-6-4-5-12(18)9-13/h4-10H,1-3H3,(H2,20,21,22)/b19-10+ |
| InChIKey | ZZIQBHKZSJZCDI-VXLYETTFSA-N |
| XLogP | 3.52 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|