C16H15BrClN3O3 — CID 110531661
1-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-chlorophenyl)urea (PubChem CID 110531661) has the molecular formula C16H15BrClN3O3 and a molecular weight of 412.67 g/mol. Its IUPAC name is 1-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 110531661 |
| Molecular Formula | C16H15BrClN3O3 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 1-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-chlorophenyl)urea |
| SMILES | COc1cc(/C=N\NC(=O)Nc2ccc(Cl)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C16H15BrClN3O3/c1-23-14-8-10(7-13(17)15(14)24-2)9-19-21-16(22)20-12-5-3-11(18)4-6-12/h3-9H,1-2H3,(H2,20,21,22)/b19-9- |
| InChIKey | VOGSUSNIMFKVFB-OCKHKDLRSA-N |
| XLogP | 4.28 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|