C18H19ClN4O5 — CID 110532065
1-(4-chlorophenyl)-3-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]urea (PubChem CID 110532065) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 110532065 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]urea |
| SMILES | CCCOc1c(OC)cc(/C=N\NC(=O)Nc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19ClN4O5/c1-3-8-28-17-15(23(25)26)9-12(10-16(17)27-2)11-20-22-18(24)21-14-6-4-13(19)5-7-14/h4-7,9-11H,3,8H2,1-2H3,(H2,21,22,24)/b20-11- |
| InChIKey | FNSHSZRETRVXDT-JAIQZWGSSA-N |
| XLogP | 4.20 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|