C19H21ClN4O5 — CID 110531249
1-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3-chlorophenyl)urea (PubChem CID 110531249) has the molecular formula C19H21ClN4O5 and a molecular weight of 420.85 g/mol. Its IUPAC name is 1-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 110531249 |
| Molecular Formula | C19H21ClN4O5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3-chlorophenyl)urea |
| SMILES | CCCCOc1c(OC)cc(/C=N\NC(=O)Nc2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21ClN4O5/c1-3-4-8-29-18-16(24(26)27)9-13(10-17(18)28-2)12-21-23-19(25)22-15-7-5-6-14(20)11-15/h5-7,9-12H,3-4,8H2,1-2H3,(H2,22,23,25)/b21-12- |
| InChIKey | GRWMPIRGRLHJOC-MTJSOVHGSA-N |
| XLogP | 4.59 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|