C20H24ClN3O3 — CID 110533106
1-(3-chlorophenyl)-3-[(Z)-(3-methoxy-4-pentoxyphenyl)methylideneamino]urea (PubChem CID 110533106) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(Z)-(3-methoxy-4-pentoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(Z)-(3-methoxy-4-pentoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 110533106 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(Z)-(3-methoxy-4-pentoxyphenyl)methylideneamino]urea |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C20H24ClN3O3/c1-3-4-5-11-27-18-10-9-15(12-19(18)26-2)14-22-24-20(25)23-17-8-6-7-16(21)13-17/h6-10,12-14H,3-5,11H2,1-2H3,(H2,23,24,25)/b22-14- |
| InChIKey | PRCCJOVIGCLHKI-HMAPJEAMSA-N |
| XLogP | 5.07 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|