C19H23N3O4 — CID 110505013
N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3,4-dimethylaniline (PubChem CID 110505013) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110505013 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3,4-dimethylaniline |
| SMILES | CCCOc1c(OC)cc(/C=N/Nc2ccc(C)c(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O4/c1-5-8-26-19-17(22(23)24)10-15(11-18(19)25-4)12-20-21-16-7-6-13(2)14(3)9-16/h6-7,9-12,21H,5,8H2,1-4H3/b20-12+ |
| InChIKey | NOSPLKUYSMZRSD-UDWIEESQSA-N |
| XLogP | 4.46 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|