C18H20N4O6 — CID 110506393
N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-nitroaniline (PubChem CID 110506393) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-nitroaniline.
| Compound Name | N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 110506393 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-nitroaniline |
| SMILES | CCCOc1c(OCC)cc(/C=N/Nc2ccc([N+](=O)[O-])cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O6/c1-3-9-28-18-16(22(25)26)10-13(11-17(18)27-4-2)12-19-20-14-5-7-15(8-6-14)21(23)24/h5-8,10-12,20H,3-4,9H2,1-2H3/b19-12+ |
| InChIKey | APZCLXPYPFQQRL-XDHOZWIPSA-N |
| XLogP | 4.14 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|