C17H18ClN3O4 — CID 50887152
4-chloro-N-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]aniline (PubChem CID 50887152) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]aniline.
| Compound Name | 4-chloro-N-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50887152 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-chloro-N-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]aniline |
| SMILES | CCOc1cc(C=NNc2ccc(Cl)cc2)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C17H18ClN3O4/c1-3-24-16-10-12(9-15(21(22)23)17(16)25-4-2)11-19-20-14-7-5-13(18)6-8-14/h5-11,20H,3-4H2,1-2H3 |
| InChIKey | IICANQPRLDTEDY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|