C16H19N5O5 — CID 136787031
2-[(2Z)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136787031) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136787031 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-[(2Z)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=N\Nc2nc(C)cc(=O)[nH]2)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C16H19N5O5/c1-4-25-13-8-11(7-12(21(23)24)15(13)26-5-2)9-17-20-16-18-10(3)6-14(22)19-16/h6-9H,4-5H2,1-3H3,(H2,18,19,20,22)/b17-9- |
| InChIKey | WBBMODFTLFKSCM-MFOYZWKCSA-N |
| XLogP | 2.23 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|