C15H18N6O5 — CID 110514444
5-[(2E)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one (PubChem CID 110514444) has the molecular formula C15H18N6O5 and a molecular weight of 362.35 g/mol. Its IUPAC name is 5-[(2E)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 110514444 |
| Molecular Formula | C15H18N6O5 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-[(2E)-2-[(3,4-diethoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
| SMILES | CCOc1cc(/C=N/Nc2nc(=O)[nH]nc2C)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C15H18N6O5/c1-4-25-12-7-10(6-11(21(23)24)13(12)26-5-2)8-16-19-14-9(3)18-20-15(22)17-14/h6-8H,4-5H2,1-3H3,(H2,17,19,20,22)/b16-8+ |
| InChIKey | LKAPGXJMQGZASO-LZYBPNLTSA-N |
| XLogP | 1.62 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|