C17H22BrN5O3 — CID 110514622
5-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]-6-tert-butyl-2H-1,2,4-triazin-3-one (PubChem CID 110514622) has the molecular formula C17H22BrN5O3 and a molecular weight of 424.30 g/mol. Its IUPAC name is 5-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]-6-tert-butyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]-6-tert-butyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 110514622 |
| Molecular Formula | C17H22BrN5O3 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 5-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]-6-tert-butyl-2H-1,2,4-triazin-3-one |
| SMILES | CCOc1c(Br)cc(/C=N/Nc2nc(=O)[nH]nc2C(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H22BrN5O3/c1-6-26-13-11(18)7-10(8-12(13)25-5)9-19-22-15-14(17(2,3)4)21-23-16(24)20-15/h7-9H,6H2,1-5H3,(H2,20,22,23,24)/b19-9+ |
| InChIKey | QKURRZLLDKYWNI-DJKKODMXSA-N |
| XLogP | 3.08 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|