C16H16BrClN2O2 — CID 110506158
N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-chloroaniline (PubChem CID 110506158) has the molecular formula C16H16BrClN2O2 and a molecular weight of 383.67 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-chloroaniline.
| Compound Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-chloroaniline |
|---|---|
| PubChem CID | 110506158 |
| Molecular Formula | C16H16BrClN2O2 |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-chloroaniline |
| SMILES | CCOc1c(Br)cc(/C=N/Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C16H16BrClN2O2/c1-3-22-16-14(17)8-11(9-15(16)21-2)10-19-20-13-6-4-12(18)5-7-13/h4-10,20H,3H2,1-2H3/b19-10+ |
| InChIKey | RPTRVXIYGNGRNR-VXLYETTFSA-N |
| XLogP | 4.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|