C17H18BrClN2O2 — CID 7971829
N-[(Z)-(3-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-chloroaniline (PubChem CID 7971829) has the molecular formula C17H18BrClN2O2 and a molecular weight of 397.70 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-chloroaniline.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-chloroaniline |
|---|---|
| PubChem CID | 7971829 |
| Molecular Formula | C17H18BrClN2O2 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-chloroaniline |
| SMILES | CCCOc1c(Br)cc(/C=N\Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C17H18BrClN2O2/c1-3-8-23-17-15(18)9-12(10-16(17)22-2)11-20-21-14-6-4-13(19)5-7-14/h4-7,9-11,21H,3,8H2,1-2H3/b20-11- |
| InChIKey | JGGOACXQEOCXMB-JAIQZWGSSA-N |
| XLogP | 5.35 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|