C16H13BrClN3O2 — CID 19579336
2-[2-bromo-4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 19579336) has the molecular formula C16H13BrClN3O2 and a molecular weight of 394.66 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 19579336 |
| Molecular Formula | C16H13BrClN3O2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=N/Nc2ccc(Cl)cc2)cc(Br)c1OCC#N |
| InChI | InChI=1S/C16H13BrClN3O2/c1-22-15-9-11(8-14(17)16(15)23-7-6-19)10-20-21-13-4-2-12(18)3-5-13/h2-5,8-10,21H,7H2,1H3/b20-10+ |
| InChIKey | KFIXETKCTDUFAG-KEBDBYFISA-N |
| XLogP | 4.46 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|