C22H21BrN2O3 — CID 110508918
N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-methoxyaniline (PubChem CID 110508918) has the molecular formula C22H21BrN2O3 and a molecular weight of 441.33 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-methoxyaniline.
| Compound Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-methoxyaniline |
|---|---|
| PubChem CID | 110508918 |
| Molecular Formula | C22H21BrN2O3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-methoxyaniline |
| SMILES | COc1ccc(N/N=C/c2cc(Br)c(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H21BrN2O3/c1-26-19-10-8-18(9-11-19)25-24-14-17-12-20(23)22(21(13-17)27-2)28-15-16-6-4-3-5-7-16/h3-14,25H,15H2,1-2H3/b24-14+ |
| InChIKey | SVZYYSGNZKDQKQ-ZVHZXABRSA-N |
| XLogP | 5.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|