C23H21BrN2O4 — CID 96883251
N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-methoxybenzamide (PubChem CID 96883251) has the molecular formula C23H21BrN2O4 and a molecular weight of 469.34 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 96883251 |
| Molecular Formula | C23H21BrN2O4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/N=C/c1cc(Br)c(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H21BrN2O4/c1-28-20-11-7-6-10-18(20)23(27)26-25-14-17-12-19(24)22(21(13-17)29-2)30-15-16-8-4-3-5-9-16/h3-14H,15H2,1-2H3,(H,26,27)/b25-14+ |
| InChIKey | JICUIJYFINQJQA-AFUMVMLFSA-N |
| XLogP | 4.81 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|