C27H22Br2N2O4 — CID 126376797
N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126376797) has the molecular formula C27H22Br2N2O4 and a molecular weight of 598.29 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126376797 |
| Molecular Formula | C27H22Br2N2O4 |
| Molecular Weight | 598.29 g/mol |
| Exact Mass | 595.99 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)N/N=C\c1cc(Br)c(OCc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H22Br2N2O4/c1-33-24-14-20-6-4-3-5-19(20)13-22(24)27(32)31-30-15-18-11-23(29)26(25(12-18)34-2)35-16-17-7-9-21(28)10-8-17/h3-15H,16H2,1-2H3,(H,31,32)/b30-15- |
| InChIKey | FSEQMWPOVFGZLE-MNDYBZJGSA-N |
| XLogP | 6.72 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.29 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|