C23H20Br2N2O5 — CID 126395065
N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126395065) has the molecular formula C23H20Br2N2O5 and a molecular weight of 564.23 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126395065 |
| Molecular Formula | C23H20Br2N2O5 |
| Molecular Weight | 564.23 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(Br)c(OCc3ccc(Br)cc3)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C23H20Br2N2O5/c1-30-17-7-8-18(20(28)11-17)23(29)27-26-12-15-9-19(25)22(21(10-15)31-2)32-13-14-3-5-16(24)6-4-14/h3-12,28H,13H2,1-2H3,(H,27,29)/b26-12- |
| InChIKey | DSCFOKBKSZTMIC-ZRGSRPPYSA-N |
| XLogP | 5.28 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|