C19H21BrN2O5 — CID 6301205
N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 6301205) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6301205 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | CCOc1c(Br)cc(/C=N\NC(=O)c2ccc(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C19H21BrN2O5/c1-5-27-18-15(20)8-12(9-17(18)26-4)11-21-22-19(23)14-7-6-13(24-2)10-16(14)25-3/h6-11H,5H2,1-4H3,(H,22,23)/b21-11- |
| InChIKey | LZQDGZCYBRQNDP-NHDPSOOVSA-N |
| XLogP | 3.64 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|