C28H24Br2N2O4 — CID 126378322
N-[(Z)-[2-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126378322) has the molecular formula C28H24Br2N2O4 and a molecular weight of 612.32 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[2-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126378322 |
| Molecular Formula | C28H24Br2N2O4 |
| Molecular Weight | 612.32 g/mol |
| Exact Mass | 610.01 |
| IUPAC Name | N-[(Z)-[2-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)c(Br)cc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H24Br2N2O4/c1-3-35-26-14-21(24(30)15-27(26)36-17-18-8-10-22(29)11-9-18)16-31-32-28(33)23-12-19-6-4-5-7-20(19)13-25(23)34-2/h4-16H,3,17H2,1-2H3,(H,32,33)/b31-16- |
| InChIKey | TURGOBKCQTVCOG-ACXHZZMFSA-N |
| XLogP | 7.11 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.32 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|