C26H20BrFN2O4 — CID 3667071
N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3667071) has the molecular formula C26H20BrFN2O4 and a molecular weight of 523.36 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3667071 |
| Molecular Formula | C26H20BrFN2O4 |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cc3ccccc3cc2O)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H20BrFN2O4/c1-33-24-12-19(22(27)13-25(24)34-15-16-6-8-20(28)9-7-16)14-29-30-26(32)21-10-17-4-2-3-5-18(17)11-23(21)31/h2-14,31H,15H2,1H3,(H,30,32) |
| InChIKey | GTUDCOXLHNCEML-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|