C25H19BrN2O3 — CID 3262456
N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3262456) has the molecular formula C25H19BrN2O3 and a molecular weight of 475.34 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3262456 |
| Molecular Formula | C25H19BrN2O3 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OCc1ccccc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C25H19BrN2O3/c26-21-10-11-24(31-16-17-6-2-1-3-7-17)20(12-21)15-27-28-25(30)22-13-18-8-4-5-9-19(18)14-23(22)29/h1-15,29H,16H2,(H,28,30) |
| InChIKey | VBTHLRSEHRABCL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|