C37H38Br2N4O4 — CID 51062342
N,N'-bis[(E)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]nonanediamide (PubChem CID 51062342) has the molecular formula C37H38Br2N4O4 and a molecular weight of 762.54 g/mol. Its IUPAC name is N,N'-bis[(E)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]nonanediamide.
| Compound Name | N,N'-bis[(E)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]nonanediamide |
|---|---|
| PubChem CID | 51062342 |
| Molecular Formula | C37H38Br2N4O4 |
| Molecular Weight | 762.54 g/mol |
| Exact Mass | 760.13 |
| IUPAC Name | N,N'-bis[(E)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)N/N=C/c1cc(Br)ccc1OCc1ccccc1)N/N=C/c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H38Br2N4O4/c38-32-18-20-34(46-26-28-12-6-4-7-13-28)30(22-32)24-40-42-36(44)16-10-2-1-3-11-17-37(45)43-41-25-31-23-33(39)19-21-35(31)47-27-29-14-8-5-9-15-29/h4-9,12-15,18-25H,1-3,10-11,16-17,26-27H2,(H,42,44)(H,43,45)/b40-24+,41-25+ |
| InChIKey | BOFNHWZSVRKTHA-FQMUTUERSA-N |
| XLogP | 8.70 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.54 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|