C27H34Br2N4O4 — CID 4149823
N,N'-bis[(5-bromo-2-propoxyphenyl)methylideneamino]heptanediamide (PubChem CID 4149823) has the molecular formula C27H34Br2N4O4 and a molecular weight of 638.40 g/mol. Its IUPAC name is N,N'-bis[(5-bromo-2-propoxyphenyl)methylideneamino]heptanediamide.
| Compound Name | N,N'-bis[(5-bromo-2-propoxyphenyl)methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 4149823 |
| Molecular Formula | C27H34Br2N4O4 |
| Molecular Weight | 638.40 g/mol |
| Exact Mass | 636.09 |
| IUPAC Name | N,N'-bis[(5-bromo-2-propoxyphenyl)methylideneamino]heptanediamide |
| SMILES | CCCOc1ccc(Br)cc1C=NNC(=O)CCCCCC(=O)NN=Cc1cc(Br)ccc1OCCC |
| InChI | InChI=1S/C27H34Br2N4O4/c1-3-14-36-24-12-10-22(28)16-20(24)18-30-32-26(34)8-6-5-7-9-27(35)33-31-19-21-17-23(29)11-13-25(21)37-15-4-2/h10-13,16-19H,3-9,14-15H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | BFEBTIVUNNQLNZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|