C35H34Br2N4O4 — CID 6263316
N,N'-bis[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]heptanediamide (PubChem CID 6263316) has the molecular formula C35H34Br2N4O4 and a molecular weight of 734.49 g/mol. Its IUPAC name is N,N'-bis[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]heptanediamide.
| Compound Name | N,N'-bis[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 6263316 |
| Molecular Formula | C35H34Br2N4O4 |
| Molecular Weight | 734.49 g/mol |
| Exact Mass | 732.09 |
| IUPAC Name | N,N'-bis[(Z)-(5-bromo-2-phenylmethoxyphenyl)methylideneamino]heptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C\c1cc(Br)ccc1OCc1ccccc1)N/N=C\c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H34Br2N4O4/c36-30-16-18-32(44-24-26-10-4-1-5-11-26)28(20-30)22-38-40-34(42)14-8-3-9-15-35(43)41-39-23-29-21-31(37)17-19-33(29)45-25-27-12-6-2-7-13-27/h1-2,4-7,10-13,16-23H,3,8-9,14-15,24-25H2,(H,40,42)(H,41,43)/b38-22-,39-23- |
| InChIKey | SNRNQXRZLFDATH-RFSISCEKSA-N |
| XLogP | 7.92 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.49 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|