C25H18BrN3O5 — CID 3506189
N-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3506189) has the molecular formula C25H18BrN3O5 and a molecular weight of 520.34 g/mol. Its IUPAC name is N-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3506189 |
| Molecular Formula | C25H18BrN3O5 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | N-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OCc1cccc([N+](=O)[O-])c1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C25H18BrN3O5/c26-20-8-9-24(34-15-16-4-3-7-21(10-16)29(32)33)19(11-20)14-27-28-25(31)22-12-17-5-1-2-6-18(17)13-23(22)30/h1-14,30H,15H2,(H,28,31) |
| InChIKey | CHHJAAWQYDXLRU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|