C20H17BrN2O4 — CID 5437236
N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5437236) has the molecular formula C20H17BrN2O4 and a molecular weight of 429.27 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5437236 |
| Molecular Formula | C20H17BrN2O4 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)c2cc3ccccc3cc2O)cc1Br |
| InChI | InChI=1S/C20H17BrN2O4/c1-26-18-10-19(27-2)16(21)8-14(18)11-22-23-20(25)15-7-12-5-3-4-6-13(12)9-17(15)24/h3-11,24H,1-2H3,(H,23,25)/b22-11- |
| InChIKey | UZAPIJUKZGTPRU-JJFYIABZSA-N |
| XLogP | 4.09 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|