C16H14Br2N2O4 — CID 1282664
5-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 1282664) has the molecular formula C16H14Br2N2O4 and a molecular weight of 458.11 g/mol. Its IUPAC name is 5-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 1282664 |
| Molecular Formula | C16H14Br2N2O4 |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 5-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)c2cc(Br)ccc2O)cc1Br |
| InChI | InChI=1S/C16H14Br2N2O4/c1-23-14-7-15(24-2)12(18)5-9(14)8-19-20-16(22)11-6-10(17)3-4-13(11)21/h3-8,21H,1-2H3,(H,20,22) |
| InChIKey | ZLQMZWQVZNMIJH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|