C20H17Br2N3O2 — CID 126077273
5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 126077273) has the molecular formula C20H17Br2N3O2 and a molecular weight of 491.18 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126077273 |
| Molecular Formula | C20H17Br2N3O2 |
| Molecular Weight | 491.18 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2cc(Br)ccc2O)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17Br2N3O2/c1-12-9-14(13(2)25(12)17-6-3-15(21)4-7-17)11-23-24-20(27)18-10-16(22)5-8-19(18)26/h3-11,26H,1-2H3,(H,24,27)/b23-11+ |
| InChIKey | NOIIDMJEWHXEQI-FOKLQQMPSA-N |
| XLogP | 5.09 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|