C19H23BrN4O2 — CID 94836482
N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-tert-butyloxamide (PubChem CID 94836482) has the molecular formula C19H23BrN4O2 and a molecular weight of 419.32 g/mol. Its IUPAC name is N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-tert-butyloxamide.
| Compound Name | N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-tert-butyloxamide |
|---|---|
| PubChem CID | 94836482 |
| Molecular Formula | C19H23BrN4O2 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-tert-butyloxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)NC(C)(C)C)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN4O2/c1-12-10-14(11-21-23-18(26)17(25)22-19(3,4)5)13(2)24(12)16-8-6-15(20)7-9-16/h6-11H,1-5H3,(H,22,25)(H,23,26)/b21-11- |
| InChIKey | GNLKYESANWFKAU-NHDPSOOVSA-N |
| XLogP | 3.22 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|