C22H21BrN4O2 — CID 3734442
N-(4-bromophenyl)-N'-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]oxamide (PubChem CID 3734442) has the molecular formula C22H21BrN4O2 and a molecular weight of 453.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3734442 |
| Molecular Formula | C22H21BrN4O2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-(4-bromophenyl)-N'-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]oxamide |
| SMILES | Cc1ccccc1-n1c(C)cc(C=NNC(=O)C(=O)Nc2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C22H21BrN4O2/c1-14-6-4-5-7-20(14)27-15(2)12-17(16(27)3)13-24-26-22(29)21(28)25-19-10-8-18(23)9-11-19/h4-13H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | YKMLHPYWBQIEGY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|