C14H15BrN4O — CID 126002556
[(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea (PubChem CID 126002556) has the molecular formula C14H15BrN4O and a molecular weight of 335.21 g/mol. Its IUPAC name is [(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea.
| Compound Name | [(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 126002556 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | [(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea |
| SMILES | Cc1cc(/C=N\NC(N)=O)c(C)n1-c1ccccc1Br |
| InChI | InChI=1S/C14H15BrN4O/c1-9-7-11(8-17-18-14(16)20)10(2)19(9)13-6-4-3-5-12(13)15/h3-8H,1-2H3,(H3,16,18,20)/b17-8- |
| InChIKey | FUUISBVGYZMRLG-IUXPMGMMSA-N |
| XLogP | 2.86 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|