C16H20N4O — CID 878182
[[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea (PubChem CID 878182) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is [[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea.
| Compound Name | [[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 878182 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]urea |
| SMILES | Cc1ccc(-n2c(C)cc(C=NNC(N)=O)c2C)cc1C |
| InChI | InChI=1S/C16H20N4O/c1-10-5-6-15(7-11(10)2)20-12(3)8-14(13(20)4)9-18-19-16(17)21/h5-9H,1-4H3,(H3,17,19,21) |
| InChIKey | XNEBYCKXXSXXQT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|