C23H22Cl2N4O2 — CID 94836817
N'-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide (PubChem CID 94836817) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is N'-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 94836817 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N'-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C\c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)cc1C |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-13-5-6-18(9-14(13)2)27-22(30)23(31)28-26-12-17-10-15(3)29(16(17)4)19-7-8-20(24)21(25)11-19/h5-12H,1-4H3,(H,27,30)(H,28,31)/b26-12- |
| InChIKey | MIKQBGGOPXERPN-ZRGSRPPYSA-N |
| XLogP | 5.11 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|