C20H17Cl2N3O — CID 126001756
N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 126001756) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126001756 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccccc2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O/c1-13-10-16(12-23-24-20(26)15-6-4-3-5-7-15)14(2)25(13)17-8-9-18(21)19(22)11-17/h3-12H,1-2H3,(H,24,26)/b23-12- |
| InChIKey | JIVUSXAYQQHXQP-FMCGGJTJSA-N |
| XLogP | 5.16 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|