C29H23Cl2N5OS — CID 3746005
N-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide (PubChem CID 3746005) has the molecular formula C29H23Cl2N5OS and a molecular weight of 560.51 g/mol. Its IUPAC name is N-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide.
| Compound Name | N-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 3746005 |
| Molecular Formula | C29H23Cl2N5OS |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | N-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
| SMILES | Cc1cc(C=NNC(=O)c2ccc(Nc3nc(-c4ccccc4)cs3)cc2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H23Cl2N5OS/c1-18-14-22(19(2)36(18)24-12-13-25(30)26(31)15-24)16-32-35-28(37)21-8-10-23(11-9-21)33-29-34-27(17-38-29)20-6-4-3-5-7-20/h3-17H,1-2H3,(H,33,34)(H,35,37) |
| InChIKey | PWWHHNGSICWCSO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|