C25H20ClN5O3S — CID 126264688
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-4-(2-anilino-1,3-thiazol-4-yl)benzamide (PubChem CID 126264688) has the molecular formula C25H20ClN5O3S and a molecular weight of 505.99 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-4-(2-anilino-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-4-(2-anilino-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 126264688 |
| Molecular Formula | C25H20ClN5O3S |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-4-(2-anilino-1,3-thiazol-4-yl)benzamide |
| SMILES | NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccccc4)n3)cc2)cc1Cl |
| InChI | InChI=1S/C25H20ClN5O3S/c26-20-12-16(6-11-22(20)34-14-23(27)32)13-28-31-24(33)18-9-7-17(8-10-18)21-15-35-25(30-21)29-19-4-2-1-3-5-19/h1-13,15H,14H2,(H2,27,32)(H,29,30)(H,31,33)/b28-13+ |
| InChIKey | VHLZGOXFBQPBET-XODNFHPESA-N |
| XLogP | 4.84 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|